C23H33N3O5S — CID 10073102
N-tert-butyl-3-[(2S,3S)-2-hydroxy-3-[(3-methyl-2-oxobutanoyl)amino]-4-phenylbutanoyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 10073102) has the molecular formula C23H33N3O5S and a molecular weight of 463.60 g/mol. Its IUPAC name is N-tert-butyl-3-[(2S,3S)-2-hydroxy-3-[(3-methyl-2-oxobutanoyl)amino]-4-phenylbutanoyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-tert-butyl-3-[(2S,3S)-2-hydroxy-3-[(3-methyl-2-oxobutanoyl)amino]-4-phenylbutanoyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 10073102 |
| Molecular Formula | C23H33N3O5S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | N-tert-butyl-3-[(2S,3S)-2-hydroxy-3-[(3-methyl-2-oxobutanoyl)amino]-4-phenylbutanoyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(C)C(=O)C(=O)N[C@@H](Cc1ccccc1)[C@H](O)C(=O)N1CSCC1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C23H33N3O5S/c1-14(2)18(27)21(30)24-16(11-15-9-7-6-8-10-15)19(28)22(31)26-13-32-12-17(26)20(29)25-23(3,4)5/h6-10,14,16-17,19,28H,11-13H2,1-5H3,(H,24,30)(H,25,29)/t16-,17?,19-/m0/s1 |
| InChIKey | JHZAKLVECGUDQX-VBIIVCKISA-N |
| XLogP | 1.12 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|