C22H35N3O2S — CID 59041396
(3aR,7aS)-5-(3-amino-2-hydroxy-4-phenylbutyl)-N-tert-butyl-3,3a,4,6,7,7a-hexahydro-2H-thieno[3,2-c]pyridine-6-carboxamide (PubChem CID 59041396) has the molecular formula C22H35N3O2S and a molecular weight of 405.61 g/mol. Its IUPAC name is (3aR,7aS)-5-(3-amino-2-hydroxy-4-phenylbutyl)-N-tert-butyl-3,3a,4,6,7,7a-hexahydro-2H-thieno[3,2-c]pyridine-6-carboxamide.
| Compound Name | (3aR,7aS)-5-(3-amino-2-hydroxy-4-phenylbutyl)-N-tert-butyl-3,3a,4,6,7,7a-hexahydro-2H-thieno[3,2-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 59041396 |
| Molecular Formula | C22H35N3O2S |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | (3aR,7aS)-5-(3-amino-2-hydroxy-4-phenylbutyl)-N-tert-butyl-3,3a,4,6,7,7a-hexahydro-2H-thieno[3,2-c]pyridine-6-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1C[C@@H]2SCC[C@@H]2CN1CC(O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C22H35N3O2S/c1-22(2,3)24-21(27)18-12-20-16(9-10-28-20)13-25(18)14-19(26)17(23)11-15-7-5-4-6-8-15/h4-8,16-20,26H,9-14,23H2,1-3H3,(H,24,27)/t16-,17?,18?,19?,20+/m1/s1 |
| InChIKey | BKURSRBJNMDHPU-WMLJFGBXSA-N |
| XLogP | 2.03 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |