C33H53N3O4S — CID 10257793
[(2R,3R)-2-butylthiolan-3-yl] N-[(2S,3R)-4-[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 10257793) has the molecular formula C33H53N3O4S and a molecular weight of 587.87 g/mol. Its IUPAC name is [(2R,3R)-2-butylthiolan-3-yl] N-[(2S,3R)-4-[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(2R,3R)-2-butylthiolan-3-yl] N-[(2S,3R)-4-[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10257793 |
| Molecular Formula | C33H53N3O4S |
| Molecular Weight | 587.87 g/mol |
| Exact Mass | 587.38 |
| IUPAC Name | [(2R,3R)-2-butylthiolan-3-yl] N-[(2S,3R)-4-[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CCCC[C@H]1SCC[C@H]1OC(=O)N[C@@H](Cc1ccccc1)[C@H](O)CN1C[C@H]2CCCC[C@H]2C[C@H]1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C33H53N3O4S/c1-5-6-16-30-29(17-18-41-30)40-32(39)34-26(19-23-12-8-7-9-13-23)28(37)22-36-21-25-15-11-10-14-24(25)20-27(36)31(38)35-33(2,3)4/h7-9,12-13,24-30,37H,5-6,10-11,14-22H2,1-4H3,(H,34,39)(H,35,38)/t24-,25+,26-,27-,28+,29+,30+/m0/s1 |
| InChIKey | OBHFVKVGTLHBQY-KZKRDFPPSA-N |
| XLogP | 5.54 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.87 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |