C31H51N3O3S — CID 142142429
N-tert-butyl-2-[3-[(3-ethylsulfanyl-3-methylbutanoyl)amino]-2-hydroxy-4-phenylbutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide (PubChem CID 142142429) has the molecular formula C31H51N3O3S and a molecular weight of 545.83 g/mol. Its IUPAC name is N-tert-butyl-2-[3-[(3-ethylsulfanyl-3-methylbutanoyl)amino]-2-hydroxy-4-phenylbutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide.
| Compound Name | N-tert-butyl-2-[3-[(3-ethylsulfanyl-3-methylbutanoyl)amino]-2-hydroxy-4-phenylbutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 142142429 |
| Molecular Formula | C31H51N3O3S |
| Molecular Weight | 545.83 g/mol |
| Exact Mass | 545.37 |
| IUPAC Name | N-tert-butyl-2-[3-[(3-ethylsulfanyl-3-methylbutanoyl)amino]-2-hydroxy-4-phenylbutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
| SMILES | CCSC(C)(C)CC(=O)NC(Cc1ccccc1)C(O)CN1CC2CCCCC2CC1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C31H51N3O3S/c1-7-38-31(5,6)19-28(36)32-25(17-22-13-9-8-10-14-22)27(35)21-34-20-24-16-12-11-15-23(24)18-26(34)29(37)33-30(2,3)4/h8-10,13-14,23-27,35H,7,11-12,15-21H2,1-6H3,(H,32,36)(H,33,37) |
| InChIKey | WPOFYXBBIWKGLV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.83 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |