C30H49N3O6S — CID 22890700
N-tert-butyl-2-[2-hydroxy-3-[(2-hydroxy-3-methyl-3-methylsulfonylbutanoyl)amino]-4-phenylbutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide (PubChem CID 22890700) has the molecular formula C30H49N3O6S and a molecular weight of 579.80 g/mol. Its IUPAC name is N-tert-butyl-2-[2-hydroxy-3-[(2-hydroxy-3-methyl-3-methylsulfonylbutanoyl)amino]-4-phenylbutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide.
| Compound Name | N-tert-butyl-2-[2-hydroxy-3-[(2-hydroxy-3-methyl-3-methylsulfonylbutanoyl)amino]-4-phenylbutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 22890700 |
| Molecular Formula | C30H49N3O6S |
| Molecular Weight | 579.80 g/mol |
| Exact Mass | 579.33 |
| IUPAC Name | N-tert-butyl-2-[2-hydroxy-3-[(2-hydroxy-3-methyl-3-methylsulfonylbutanoyl)amino]-4-phenylbutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1CC2CCCCC2CN1CC(O)C(Cc1ccccc1)NC(=O)C(O)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C30H49N3O6S/c1-29(2,3)32-27(36)24-17-21-14-10-11-15-22(21)18-33(24)19-25(34)23(16-20-12-8-7-9-13-20)31-28(37)26(35)30(4,5)40(6,38)39/h7-9,12-13,21-26,34-35H,10-11,14-19H2,1-6H3,(H,31,37)(H,32,36) |
| InChIKey | HABLESBTALTTQO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.80 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |