C37H56N4O5S — CID 22890824
2-[3-[[2-(benzylamino)-3-methyl-3-methylsulfonylbutanoyl]amino]-2-hydroxy-4-phenylbutyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide (PubChem CID 22890824) has the molecular formula C37H56N4O5S and a molecular weight of 668.95 g/mol. Its IUPAC name is 2-[3-[[2-(benzylamino)-3-methyl-3-methylsulfonylbutanoyl]amino]-2-hydroxy-4-phenylbutyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide.
| Compound Name | 2-[3-[[2-(benzylamino)-3-methyl-3-methylsulfonylbutanoyl]amino]-2-hydroxy-4-phenylbutyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 22890824 |
| Molecular Formula | C37H56N4O5S |
| Molecular Weight | 668.95 g/mol |
| Exact Mass | 668.40 |
| IUPAC Name | 2-[3-[[2-(benzylamino)-3-methyl-3-methylsulfonylbutanoyl]amino]-2-hydroxy-4-phenylbutyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1CC2CCCCC2CN1CC(O)C(Cc1ccccc1)NC(=O)C(NCc1ccccc1)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C37H56N4O5S/c1-36(2,3)40-34(43)31-22-28-19-13-14-20-29(28)24-41(31)25-32(42)30(21-26-15-9-7-10-16-26)39-35(44)33(37(4,5)47(6,45)46)38-23-27-17-11-8-12-18-27/h7-12,15-18,28-33,38,42H,13-14,19-25H2,1-6H3,(H,39,44)(H,40,43) |
| InChIKey | OFPVWKMQHXUFGN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.95 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |