C37H54N4O6S — CID 22890820
2-[3-[(2-benzamido-3-methyl-3-methylsulfonylbutanoyl)amino]-2-hydroxy-4-phenylbutyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide (PubChem CID 22890820) has the molecular formula C37H54N4O6S and a molecular weight of 682.93 g/mol. Its IUPAC name is 2-[3-[(2-benzamido-3-methyl-3-methylsulfonylbutanoyl)amino]-2-hydroxy-4-phenylbutyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide.
| Compound Name | 2-[3-[(2-benzamido-3-methyl-3-methylsulfonylbutanoyl)amino]-2-hydroxy-4-phenylbutyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 22890820 |
| Molecular Formula | C37H54N4O6S |
| Molecular Weight | 682.93 g/mol |
| Exact Mass | 682.38 |
| IUPAC Name | 2-[3-[(2-benzamido-3-methyl-3-methylsulfonylbutanoyl)amino]-2-hydroxy-4-phenylbutyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1CC2CCCCC2CN1CC(O)C(Cc1ccccc1)NC(=O)C(NC(=O)c1ccccc1)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C37H54N4O6S/c1-36(2,3)40-34(44)30-22-27-19-13-14-20-28(27)23-41(30)24-31(42)29(21-25-15-9-7-10-16-25)38-35(45)32(37(4,5)48(6,46)47)39-33(43)26-17-11-8-12-18-26/h7-12,15-18,27-32,42H,13-14,19-24H2,1-6H3,(H,38,45)(H,39,43)(H,40,44) |
| InChIKey | CSZHTDQPZAMTHE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.93 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |