C23H37N3O2S — CID 59915602
(3S,4aS,8aS)-2-[(2R,3S)-3-amino-2-hydroxy-3-phenylsulfanylpropyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide (PubChem CID 59915602) has the molecular formula C23H37N3O2S and a molecular weight of 419.64 g/mol. Its IUPAC name is (3S,4aS,8aS)-2-[(2R,3S)-3-amino-2-hydroxy-3-phenylsulfanylpropyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S,4aS,8aS)-2-[(2R,3S)-3-amino-2-hydroxy-3-phenylsulfanylpropyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 59915602 |
| Molecular Formula | C23H37N3O2S |
| Molecular Weight | 419.64 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | (3S,4aS,8aS)-2-[(2R,3S)-3-amino-2-hydroxy-3-phenylsulfanylpropyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2CN1C[C@@H](O)[C@@H](N)Sc1ccccc1 |
| InChI | InChI=1S/C23H37N3O2S/c1-23(2,3)25-22(28)19-13-16-9-7-8-10-17(16)14-26(19)15-20(27)21(24)29-18-11-5-4-6-12-18/h4-6,11-12,16-17,19-21,27H,7-10,13-15,24H2,1-3H3,(H,25,28)/t16-,17+,19-,20+,21-/m0/s1 |
| InChIKey | ZBVCIVDJEKEIFE-NXIXHYNASA-N |
| XLogP | 3.22 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.64 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|