C30H48N4O11S — CID 160902962
1-O-tert-butyl 2-O-methyl (2S)-4-(3-oxobutanethioyl)piperazine-1,2-dicarboxylate;1-O-tert-butyl 2-O-methyl (2S)-4-(3-oxobutanoyl)piperazine-1,2-dicarboxylate (PubChem CID 160902962) has the molecular formula C30H48N4O11S and a molecular weight of 672.80 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S)-4-(3-oxobutanethioyl)piperazine-1,2-dicarboxylate;1-O-tert-butyl 2-O-methyl (2S)-4-(3-oxobutanoyl)piperazine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S)-4-(3-oxobutanethioyl)piperazine-1,2-dicarboxylate;1-O-tert-butyl 2-O-methyl (2S)-4-(3-oxobutanoyl)piperazine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 160902962 |
| Molecular Formula | C30H48N4O11S |
| Molecular Weight | 672.80 g/mol |
| Exact Mass | 672.30 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S)-4-(3-oxobutanethioyl)piperazine-1,2-dicarboxylate;1-O-tert-butyl 2-O-methyl (2S)-4-(3-oxobutanoyl)piperazine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CN(C(=O)CC(C)=O)CCN1C(=O)OC(C)(C)C.COC(=O)[C@@H]1CN(C(=S)CC(C)=O)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H24N2O6.C15H24N2O5S/c1-10(18)8-12(19)16-6-7-17(11(9-16)13(20)22-5)14(21)23-15(2,3)4;1-10(18)8-12(23)16-6-7-17(11(9-16)13(19)21-5)14(20)22-15(2,3)4/h2*11H,6-9H2,1-5H3/t2*11-/m00/s1 |
| InChIKey | SPTJBHLMHVMULS-QHUNOZLZSA-N |
| XLogP | 1.97 |
| TPSA | 169.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.80 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|