C16H22F3N3O3 — CID 72519180
prop-2-enyl 4-(2-methylbut-3-yn-2-yl)-2-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylate (PubChem CID 72519180) has the molecular formula C16H22F3N3O3 and a molecular weight of 361.36 g/mol. Its IUPAC name is prop-2-enyl 4-(2-methylbut-3-yn-2-yl)-2-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylate.
| Compound Name | prop-2-enyl 4-(2-methylbut-3-yn-2-yl)-2-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 72519180 |
| Molecular Formula | C16H22F3N3O3 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | prop-2-enyl 4-(2-methylbut-3-yn-2-yl)-2-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylate |
| SMILES | C#CC(C)(C)N1CCN(C(=O)OCC=C)C(C(=O)NCC(F)(F)F)C1 |
| InChI | InChI=1S/C16H22F3N3O3/c1-5-9-25-14(24)22-8-7-21(15(3,4)6-2)10-12(22)13(23)20-11-16(17,18)19/h2,5,12H,1,7-11H2,3-4H3,(H,20,23) |
| InChIKey | YVNVRMXPNLNQBY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|