C16H23NO4S2 — CID 141225435
2-O-methyl 1-O-prop-2-enyl 4-[2-(1,3-dithiol-2-yl)ethyl]piperidine-1,2-dicarboxylate (PubChem CID 141225435) has the molecular formula C16H23NO4S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 2-O-methyl 1-O-prop-2-enyl 4-[2-(1,3-dithiol-2-yl)ethyl]piperidine-1,2-dicarboxylate.
| Compound Name | 2-O-methyl 1-O-prop-2-enyl 4-[2-(1,3-dithiol-2-yl)ethyl]piperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 141225435 |
| Molecular Formula | C16H23NO4S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 2-O-methyl 1-O-prop-2-enyl 4-[2-(1,3-dithiol-2-yl)ethyl]piperidine-1,2-dicarboxylate |
| SMILES | C=CCOC(=O)N1CCC(CCC2SC=CS2)CC1C(=O)OC |
| InChI | InChI=1S/C16H23NO4S2/c1-3-8-21-16(19)17-7-6-12(11-13(17)15(18)20-2)4-5-14-22-9-10-23-14/h3,9-10,12-14H,1,4-8,11H2,2H3 |
| InChIKey | BAAXLVDQAFZCTE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|