C20H24F3N3O3 — CID 59108639
benzyl (2S)-4-(2-methylbut-3-yn-2-yl)-2-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylate (PubChem CID 59108639) has the molecular formula C20H24F3N3O3 and a molecular weight of 411.42 g/mol. Its IUPAC name is benzyl (2S)-4-(2-methylbut-3-yn-2-yl)-2-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylate.
| Compound Name | benzyl (2S)-4-(2-methylbut-3-yn-2-yl)-2-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59108639 |
| Molecular Formula | C20H24F3N3O3 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | benzyl (2S)-4-(2-methylbut-3-yn-2-yl)-2-(2,2,2-trifluoroethylcarbamoyl)piperazine-1-carboxylate |
| SMILES | C#CC(C)(C)N1CCN(C(=O)OCc2ccccc2)[C@H](C(=O)NCC(F)(F)F)C1 |
| InChI | InChI=1S/C20H24F3N3O3/c1-4-19(2,3)25-10-11-26(16(12-25)17(27)24-14-20(21,22)23)18(28)29-13-15-8-6-5-7-9-15/h1,5-9,16H,10-14H2,2-3H3,(H,24,27)/t16-/m0/s1 |
| InChIKey | RQZYWLOYRMMFFI-INIZCTEOSA-N |
| XLogP | 2.40 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|