C16H25F3N2O2 — CID 178136584
(E)-3-amino-2-phenylmethoxy-N-(2,2,2-trifluoroethyl)prop-2-enamide;ethane (PubChem CID 178136584) has the molecular formula C16H25F3N2O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is (E)-3-amino-2-phenylmethoxy-N-(2,2,2-trifluoroethyl)prop-2-enamide;ethane.
| Compound Name | (E)-3-amino-2-phenylmethoxy-N-(2,2,2-trifluoroethyl)prop-2-enamide;ethane |
|---|---|
| PubChem CID | 178136584 |
| Molecular Formula | C16H25F3N2O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (E)-3-amino-2-phenylmethoxy-N-(2,2,2-trifluoroethyl)prop-2-enamide;ethane |
| SMILES | CC.CC.N/C=C(/OCc1ccccc1)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H13F3N2O2.2C2H6/c13-12(14,15)8-17-11(18)10(6-16)19-7-9-4-2-1-3-5-9;2*1-2/h1-6H,7-8,16H2,(H,17,18);2*1-2H3/b10-6+;; |
| InChIKey | PFENWLNXAOFVEG-DOLBFOAYSA-N |
| XLogP | 3.73 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|