C16H21F3N2O5 — CID 151119875
tert-butyl (2R,5R)-5-[2,3-dioxo-3-(2,2,2-trifluoroethylamino)propyl]-2-ethynylmorpholine-4-carboxylate (PubChem CID 151119875) has the molecular formula C16H21F3N2O5 and a molecular weight of 378.35 g/mol. Its IUPAC name is tert-butyl (2R,5R)-5-[2,3-dioxo-3-(2,2,2-trifluoroethylamino)propyl]-2-ethynylmorpholine-4-carboxylate.
| Compound Name | tert-butyl (2R,5R)-5-[2,3-dioxo-3-(2,2,2-trifluoroethylamino)propyl]-2-ethynylmorpholine-4-carboxylate |
|---|---|
| PubChem CID | 151119875 |
| Molecular Formula | C16H21F3N2O5 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | tert-butyl (2R,5R)-5-[2,3-dioxo-3-(2,2,2-trifluoroethylamino)propyl]-2-ethynylmorpholine-4-carboxylate |
| SMILES | C#C[C@@H]1CN(C(=O)OC(C)(C)C)[C@H](CC(=O)C(=O)NCC(F)(F)F)CO1 |
| InChI | InChI=1S/C16H21F3N2O5/c1-5-11-7-21(14(24)26-15(2,3)4)10(8-25-11)6-12(22)13(23)20-9-16(17,18)19/h1,10-11H,6-9H2,2-4H3,(H,20,23)/t10-,11-/m1/s1 |
| InChIKey | MRYNDEUQBYIHRQ-GHMZBOCLSA-N |
| XLogP | 1.26 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|