C23H36FN3O4Si — CID 144871019
tert-butyl 2-[2-(3-amino-5-fluoro-4-pyridinyl)ethynyl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]morpholine-4-carboxylate (PubChem CID 144871019) has the molecular formula C23H36FN3O4Si and a molecular weight of 465.64 g/mol. Its IUPAC name is tert-butyl 2-[2-(3-amino-5-fluoro-4-pyridinyl)ethynyl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-[2-(3-amino-5-fluoro-4-pyridinyl)ethynyl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 144871019 |
| Molecular Formula | C23H36FN3O4Si |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | tert-butyl 2-[2-(3-amino-5-fluoro-4-pyridinyl)ethynyl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C#Cc2c(N)cncc2F)OCC1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H36FN3O4Si/c1-22(2,3)31-21(28)27-13-17(9-10-18-19(24)11-26-12-20(18)25)29-14-16(27)15-30-32(7,8)23(4,5)6/h11-12,16-17H,13-15,25H2,1-8H3 |
| InChIKey | HQYWHPVNRYOVHP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 86.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|