C19H34F3NO3Si — CID 145444558
tert-butyl (2S,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(Z)-3,3,3-trifluoroprop-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 145444558) has the molecular formula C19H34F3NO3Si and a molecular weight of 409.57 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(Z)-3,3,3-trifluoroprop-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(Z)-3,3,3-trifluoroprop-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 145444558 |
| Molecular Formula | C19H34F3NO3Si |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | tert-butyl (2S,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(Z)-3,3,3-trifluoroprop-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](/C=C\C(F)(F)F)C[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34F3NO3Si/c1-17(2,3)26-16(24)23-12-14(9-10-19(20,21)22)11-15(23)13-25-27(7,8)18(4,5)6/h9-10,14-15H,11-13H2,1-8H3/b10-9-/t14-,15-/m0/s1 |
| InChIKey | HBFKNIZKDAELKM-KZZSIXTMSA-N |
| XLogP | 5.75 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|