C26H54N2O5Si2 — CID 140854447
tert-butyl (2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(prop-2-enoxyamino)piperidine-1-carboxylate (PubChem CID 140854447) has the molecular formula C26H54N2O5Si2 and a molecular weight of 530.90 g/mol. Its IUPAC name is tert-butyl (2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(prop-2-enoxyamino)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(prop-2-enoxyamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140854447 |
| Molecular Formula | C26H54N2O5Si2 |
| Molecular Weight | 530.90 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | tert-butyl (2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(prop-2-enoxyamino)piperidine-1-carboxylate |
| SMILES | C=CCON[C@H]1CN(C(=O)OC(C)(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H54N2O5Si2/c1-15-16-30-27-21-18-28(23(29)32-24(2,3)4)20(19-31-34(11,12)25(5,6)7)17-22(21)33-35(13,14)26(8,9)10/h15,20-22,27H,1,16-19H2,2-14H3/t20-,21-,22-/m0/s1 |
| InChIKey | KALVDAGEEDUXLZ-FKBYEOEOSA-N |
| XLogP | 6.48 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.90 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|