C17H34BN2O3Si — CID 161341395
CID 161341395 (PubChem CID 161341395) has the molecular formula C17H34BN2O3Si and a molecular weight of 353.37 g/mol.
| Compound Name | CID 161341395 |
|---|---|
| PubChem CID | 161341395 |
| Molecular Formula | C17H34BN2O3Si |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | — |
| SMILES | C=CCON[C@H]1CN([B]C=O)[C@H](CC)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34BN2O3Si/c1-8-10-22-19-15-12-20(18-13-21)14(9-2)11-16(15)23-24(6,7)17(3,4)5/h8,13-16,19H,1,9-12H2,2-7H3/t14-,15+,16+/m1/s1 |
| InChIKey | NSJHLHBOQWOERE-PMPSAXMXSA-N |
| XLogP | 2.75 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|