C20H30F3N3O5 — CID 142189542
tert-butyl 4-[[(2S,4R)-5-oxo-4-prop-2-ynyloxolan-2-yl]methyl]piperazine-1-carboxylate;N-(2,2,2-trifluoroethyl)formamide (PubChem CID 142189542) has the molecular formula C20H30F3N3O5 and a molecular weight of 449.47 g/mol. Its IUPAC name is tert-butyl 4-[[(2S,4R)-5-oxo-4-prop-2-ynyloxolan-2-yl]methyl]piperazine-1-carboxylate;N-(2,2,2-trifluoroethyl)formamide.
| Compound Name | tert-butyl 4-[[(2S,4R)-5-oxo-4-prop-2-ynyloxolan-2-yl]methyl]piperazine-1-carboxylate;N-(2,2,2-trifluoroethyl)formamide |
|---|---|
| PubChem CID | 142189542 |
| Molecular Formula | C20H30F3N3O5 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | tert-butyl 4-[[(2S,4R)-5-oxo-4-prop-2-ynyloxolan-2-yl]methyl]piperazine-1-carboxylate;N-(2,2,2-trifluoroethyl)formamide |
| SMILES | C#CC[C@@H]1C[C@@H](CN2CCN(C(=O)OC(C)(C)C)CC2)OC1=O.O=CNCC(F)(F)F |
| InChI | InChI=1S/C17H26N2O4.C3H4F3NO/c1-5-6-13-11-14(22-15(13)20)12-18-7-9-19(10-8-18)16(21)23-17(2,3)4;4-3(5,6)1-7-2-8/h1,13-14H,6-12H2,2-4H3;2H,1H2,(H,7,8)/t13-,14+;/m1./s1 |
| InChIKey | VRAOBGHOAMBLNP-DFQHDRSWSA-N |
| XLogP | 1.79 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|