C12H19F5N2O2 — CID 121294490
tert-butyl 4-(2,2,3,3,3-pentafluoropropyl)piperazine-1-carboxylate (PubChem CID 121294490) has the molecular formula C12H19F5N2O2 and a molecular weight of 318.29 g/mol. Its IUPAC name is tert-butyl 4-(2,2,3,3,3-pentafluoropropyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2,2,3,3,3-pentafluoropropyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 121294490 |
| Molecular Formula | C12H19F5N2O2 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | tert-butyl 4-(2,2,3,3,3-pentafluoropropyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H19F5N2O2/c1-10(2,3)21-9(20)19-6-4-18(5-7-19)8-11(13,14)12(15,16)17/h4-8H2,1-3H3 |
| InChIKey | SDHLTWCRYHMFLB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|