C22H40N2O4S — CID 142200983
tert-butyl 4-[3-(1-but-3-enylsulfonylpiperidin-4-yl)propyl]piperidine-1-carboxylate (PubChem CID 142200983) has the molecular formula C22H40N2O4S and a molecular weight of 428.64 g/mol. Its IUPAC name is tert-butyl 4-[3-(1-but-3-enylsulfonylpiperidin-4-yl)propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(1-but-3-enylsulfonylpiperidin-4-yl)propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142200983 |
| Molecular Formula | C22H40N2O4S |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | tert-butyl 4-[3-(1-but-3-enylsulfonylpiperidin-4-yl)propyl]piperidine-1-carboxylate |
| SMILES | C=CCCS(=O)(=O)N1CCC(CCCC2CCN(C(=O)OC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C22H40N2O4S/c1-5-6-18-29(26,27)24-16-12-20(13-17-24)9-7-8-19-10-14-23(15-11-19)21(25)28-22(2,3)4/h5,19-20H,1,6-18H2,2-4H3 |
| InChIKey | FVECMBOOXLMIBC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|