C14H25NO3 — CID 71762891
tert-butyl 3-but-3-enyl-3-hydroxypiperidine-1-carboxylate (PubChem CID 71762891) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is tert-butyl 3-but-3-enyl-3-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-but-3-enyl-3-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 71762891 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | tert-butyl 3-but-3-enyl-3-hydroxypiperidine-1-carboxylate |
| SMILES | C=CCCC1(O)CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H25NO3/c1-5-6-8-14(17)9-7-10-15(11-14)12(16)18-13(2,3)4/h5,17H,1,6-11H2,2-4H3 |
| InChIKey | MGQLFZJIGKCVSH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|