C17H24N3O6- — CID 163429009
[2-carboxy-5-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]phenyl]-methyl-dioxidoazanium (PubChem CID 163429009) has the molecular formula C17H24N3O6- and a molecular weight of 366.39 g/mol. Its IUPAC name is [2-carboxy-5-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]phenyl]-methyl-dioxidoazanium.
| Compound Name | [2-carboxy-5-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]phenyl]-methyl-dioxidoazanium |
|---|---|
| PubChem CID | 163429009 |
| Molecular Formula | C17H24N3O6- |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | [2-carboxy-5-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]phenyl]-methyl-dioxidoazanium |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C(=O)O)c([N+](C)([O-])[O-])c2)CC1 |
| InChI | InChI=1S/C17H24N3O6/c1-17(2,3)26-16(23)19-9-7-18(8-10-19)12-5-6-13(15(21)22)14(11-12)20(4,24)25/h5-6,11H,7-10H2,1-4H3,(H,21,22)/q-1 |
| InChIKey | AOWNXPOPYYUJJQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|