C22H34N2O2S — CID 25191101
1-(2-bicyclo[2.2.1]heptanyl)-4-(4-tert-butylphenyl)sulfonyl-1,4-diazepane (PubChem CID 25191101) has the molecular formula C22H34N2O2S and a molecular weight of 390.59 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-4-(4-tert-butylphenyl)sulfonyl-1,4-diazepane.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-4-(4-tert-butylphenyl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 25191101 |
| Molecular Formula | C22H34N2O2S |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-4-(4-tert-butylphenyl)sulfonyl-1,4-diazepane |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCCN(C3CC4CCC3C4)CC2)cc1 |
| InChI | InChI=1S/C22H34N2O2S/c1-22(2,3)19-7-9-20(10-8-19)27(25,26)24-12-4-11-23(13-14-24)21-16-17-5-6-18(21)15-17/h7-10,17-18,21H,4-6,11-16H2,1-3H3 |
| InChIKey | YGRHRIIOPNIBKB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |