C21H34N2O2S — CID 1459965
1-(4-tert-butylphenyl)sulfonyl-4-[(1S,2S)-2-methylcyclohexyl]piperazine (PubChem CID 1459965) has the molecular formula C21H34N2O2S and a molecular weight of 378.58 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)sulfonyl-4-[(1S,2S)-2-methylcyclohexyl]piperazine.
| Compound Name | 1-(4-tert-butylphenyl)sulfonyl-4-[(1S,2S)-2-methylcyclohexyl]piperazine |
|---|---|
| PubChem CID | 1459965 |
| Molecular Formula | C21H34N2O2S |
| Molecular Weight | 378.58 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 1-(4-tert-butylphenyl)sulfonyl-4-[(1S,2S)-2-methylcyclohexyl]piperazine |
| SMILES | C[C@H]1CCCC[C@@H]1N1CCN(S(=O)(=O)c2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C21H34N2O2S/c1-17-7-5-6-8-20(17)22-13-15-23(16-14-22)26(24,25)19-11-9-18(10-12-19)21(2,3)4/h9-12,17,20H,5-8,13-16H2,1-4H3/t17-,20-/m0/s1 |
| InChIKey | SVSXLBRHFDFOOD-PXNSSMCTSA-N |
| XLogP | 3.87 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |