C18H20Cl2FN2O2S+ — CID 8599548
1-(2,6-dichlorophenyl)sulfonyl-4-[(1S)-1-(4-fluorophenyl)ethyl]piperazin-4-ium (PubChem CID 8599548) has the molecular formula C18H20Cl2FN2O2S+ and a molecular weight of 418.34 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)sulfonyl-4-[(1S)-1-(4-fluorophenyl)ethyl]piperazin-4-ium.
| Compound Name | 1-(2,6-dichlorophenyl)sulfonyl-4-[(1S)-1-(4-fluorophenyl)ethyl]piperazin-4-ium |
|---|---|
| PubChem CID | 8599548 |
| Molecular Formula | C18H20Cl2FN2O2S+ |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 1-(2,6-dichlorophenyl)sulfonyl-4-[(1S)-1-(4-fluorophenyl)ethyl]piperazin-4-ium |
| SMILES | C[C@@H](c1ccc(F)cc1)[NH+]1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C18H19Cl2FN2O2S/c1-13(14-5-7-15(21)8-6-14)22-9-11-23(12-10-22)26(24,25)18-16(19)3-2-4-17(18)20/h2-8,13H,9-12H2,1H3/p+1/t13-/m0/s1 |
| InChIKey | FCLBZTAZDMNPSR-ZDUSSCGKSA-O |
| XLogP | 2.78 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |