C16H22FN4O3S+ — CID 150450036
1-(2,3-dimethylimidazol-3-ium-1-yl)sulfonyl-4-(4-fluoro-2-methoxyphenyl)piperazine (PubChem CID 150450036) has the molecular formula C16H22FN4O3S+ and a molecular weight of 369.44 g/mol. Its IUPAC name is 1-(2,3-dimethylimidazol-3-ium-1-yl)sulfonyl-4-(4-fluoro-2-methoxyphenyl)piperazine.
| Compound Name | 1-(2,3-dimethylimidazol-3-ium-1-yl)sulfonyl-4-(4-fluoro-2-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 150450036 |
| Molecular Formula | C16H22FN4O3S+ |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-(2,3-dimethylimidazol-3-ium-1-yl)sulfonyl-4-(4-fluoro-2-methoxyphenyl)piperazine |
| SMILES | COc1cc(F)ccc1N1CCN(S(=O)(=O)n2cc[n+](C)c2C)CC1 |
| InChI | InChI=1S/C16H22FN4O3S/c1-13-18(2)6-11-21(13)25(22,23)20-9-7-19(8-10-20)15-5-4-14(17)12-16(15)24-3/h4-6,11-12H,7-10H2,1-3H3/q+1 |
| InChIKey | HNOZRBCLRFTMIZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 58.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|