C32H35FN2O7S2 — CID 155077314
1-[(9Z)-7-(4,4-dimethylcyclohexyl)sulfonyl-9-hydroxyiminofluoren-2-yl]sulfonyl-4-(4-fluoro-2-hydroxyphenyl)piperidin-4-ol (PubChem CID 155077314) has the molecular formula C32H35FN2O7S2 and a molecular weight of 642.77 g/mol. Its IUPAC name is 1-[(9Z)-7-(4,4-dimethylcyclohexyl)sulfonyl-9-hydroxyiminofluoren-2-yl]sulfonyl-4-(4-fluoro-2-hydroxyphenyl)piperidin-4-ol.
| Compound Name | 1-[(9Z)-7-(4,4-dimethylcyclohexyl)sulfonyl-9-hydroxyiminofluoren-2-yl]sulfonyl-4-(4-fluoro-2-hydroxyphenyl)piperidin-4-ol |
|---|---|
| PubChem CID | 155077314 |
| Molecular Formula | C32H35FN2O7S2 |
| Molecular Weight | 642.77 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | 1-[(9Z)-7-(4,4-dimethylcyclohexyl)sulfonyl-9-hydroxyiminofluoren-2-yl]sulfonyl-4-(4-fluoro-2-hydroxyphenyl)piperidin-4-ol |
| SMILES | CC1(C)CCC(S(=O)(=O)c2ccc3c(c2)/C(=N/O)c2cc(S(=O)(=O)N4CCC(O)(c5ccc(F)cc5O)CC4)ccc2-3)CC1 |
| InChI | InChI=1S/C32H35FN2O7S2/c1-31(2)11-9-21(10-12-31)43(39,40)22-4-6-24-25-7-5-23(19-27(25)30(34-38)26(24)18-22)44(41,42)35-15-13-32(37,14-16-35)28-8-3-20(33)17-29(28)36/h3-8,17-19,21,36-38H,9-16H2,1-2H3/b34-30- |
| InChIKey | DFQZMJCQNBFTQJ-BVNFUTIRSA-N |
| XLogP | 5.15 |
| TPSA | 144.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.77 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|