C21H25N3O4S — CID 3457442
N'-[1-(2-hydroxyphenyl)ethenyl]-1-(4-methylphenyl)sulfonylpiperidine-4-carbohydrazide (PubChem CID 3457442) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is N'-[1-(2-hydroxyphenyl)ethenyl]-1-(4-methylphenyl)sulfonylpiperidine-4-carbohydrazide.
| Compound Name | N'-[1-(2-hydroxyphenyl)ethenyl]-1-(4-methylphenyl)sulfonylpiperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 3457442 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | N'-[1-(2-hydroxyphenyl)ethenyl]-1-(4-methylphenyl)sulfonylpiperidine-4-carbohydrazide |
| SMILES | C=C(NNC(=O)C1CCN(S(=O)(=O)c2ccc(C)cc2)CC1)c1ccccc1O |
| InChI | InChI=1S/C21H25N3O4S/c1-15-7-9-18(10-8-15)29(27,28)24-13-11-17(12-14-24)21(26)23-22-16(2)19-5-3-4-6-20(19)25/h3-10,17,22,25H,2,11-14H2,1H3,(H,23,26) |
| InChIKey | RDSQGBQYKZEXRD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|