C27H32F2N2O7 — CID 14698767
6-[2-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]ethyl]-3-methyl-1,3-oxazinan-2-one;oxalic acid (PubChem CID 14698767) has the molecular formula C27H32F2N2O7 and a molecular weight of 534.56 g/mol. Its IUPAC name is 6-[2-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]ethyl]-3-methyl-1,3-oxazinan-2-one;oxalic acid.
| Compound Name | 6-[2-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]ethyl]-3-methyl-1,3-oxazinan-2-one;oxalic acid |
|---|---|
| PubChem CID | 14698767 |
| Molecular Formula | C27H32F2N2O7 |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 6-[2-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]ethyl]-3-methyl-1,3-oxazinan-2-one;oxalic acid |
| SMILES | CN1CCC(CCN2CCC(C(O)(c3ccc(F)cc3)c3ccc(F)cc3)CC2)OC1=O.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H30F2N2O3.C2H2O4/c1-28-14-12-23(32-24(28)30)13-17-29-15-10-20(11-16-29)25(31,18-2-6-21(26)7-3-18)19-4-8-22(27)9-5-19;3-1(4)2(5)6/h2-9,20,23,31H,10-17H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | IUWDLGTYNVZUJE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|