C32H34F2N2O7 — CID 14698759
3-benzyl-5-[2-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]ethyl]-1,3-oxazolidin-2-one;oxalic acid (PubChem CID 14698759) has the molecular formula C32H34F2N2O7 and a molecular weight of 596.63 g/mol. Its IUPAC name is 3-benzyl-5-[2-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]ethyl]-1,3-oxazolidin-2-one;oxalic acid.
| Compound Name | 3-benzyl-5-[2-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]ethyl]-1,3-oxazolidin-2-one;oxalic acid |
|---|---|
| PubChem CID | 14698759 |
| Molecular Formula | C32H34F2N2O7 |
| Molecular Weight | 596.63 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | 3-benzyl-5-[2-[4-[bis(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]ethyl]-1,3-oxazolidin-2-one;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C1OC(CCN2CCC(C(O)(c3ccc(F)cc3)c3ccc(F)cc3)CC2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C30H32F2N2O3.C2H2O4/c31-26-10-6-23(7-11-26)30(36,24-8-12-27(32)13-9-24)25-14-17-33(18-15-25)19-16-28-21-34(29(35)37-28)20-22-4-2-1-3-5-22;3-1(4)2(5)6/h1-13,25,28,36H,14-21H2;(H,3,4)(H,5,6) |
| InChIKey | XXUVRTDPJDWBNB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.63 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|