C32H33F2NO6S — CID 54320445
4-[bis(4-fluorophenyl)-[1-[3-(4-methylsulfinylphenoxy)propyl]piperidin-4-yl]methoxy]-4-oxobut-2-enoic acid (PubChem CID 54320445) has the molecular formula C32H33F2NO6S and a molecular weight of 597.68 g/mol. Its IUPAC name is 4-[bis(4-fluorophenyl)-[1-[3-(4-methylsulfinylphenoxy)propyl]piperidin-4-yl]methoxy]-4-oxobut-2-enoic acid.
| Compound Name | 4-[bis(4-fluorophenyl)-[1-[3-(4-methylsulfinylphenoxy)propyl]piperidin-4-yl]methoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 54320445 |
| Molecular Formula | C32H33F2NO6S |
| Molecular Weight | 597.68 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | 4-[bis(4-fluorophenyl)-[1-[3-(4-methylsulfinylphenoxy)propyl]piperidin-4-yl]methoxy]-4-oxobut-2-enoic acid |
| SMILES | CS(=O)c1ccc(OCCCN2CCC(C(OC(=O)C=CC(=O)O)(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C32H33F2NO6S/c1-42(39)29-13-11-28(12-14-29)40-22-2-19-35-20-17-25(18-21-35)32(23-3-7-26(33)8-4-23,24-5-9-27(34)10-6-24)41-31(38)16-15-30(36)37/h3-16,25H,2,17-22H2,1H3,(H,36,37) |
| InChIKey | SRGKRZVDYBEWJF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|