C31H36F2N2O6 — CID 70392622
4-[3-[4-[bis(4-fluorophenyl)methyl]piperidin-1-yl]propoxy]aniline;but-2-enedioic acid;hydrate (PubChem CID 70392622) has the molecular formula C31H36F2N2O6 and a molecular weight of 570.63 g/mol. Its IUPAC name is 4-[3-[4-[bis(4-fluorophenyl)methyl]piperidin-1-yl]propoxy]aniline;but-2-enedioic acid;hydrate.
| Compound Name | 4-[3-[4-[bis(4-fluorophenyl)methyl]piperidin-1-yl]propoxy]aniline;but-2-enedioic acid;hydrate |
|---|---|
| PubChem CID | 70392622 |
| Molecular Formula | C31H36F2N2O6 |
| Molecular Weight | 570.63 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 4-[3-[4-[bis(4-fluorophenyl)methyl]piperidin-1-yl]propoxy]aniline;but-2-enedioic acid;hydrate |
| SMILES | Nc1ccc(OCCCN2CCC(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc1.O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C27H30F2N2O.C4H4O4.H2O/c28-23-6-2-20(3-7-23)27(21-4-8-24(29)9-5-21)22-14-17-31(18-15-22)16-1-19-32-26-12-10-25(30)11-13-26;5-3(6)1-2-4(7)8;/h2-13,22,27H,1,14-19,30H2;1-2H,(H,5,6)(H,7,8);1H2 |
| InChIKey | UVVKCMCOPBNZCB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 144.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|