C21H23F2NO4 — CID 51952508
4-(4-acetyl-2-methoxyphenoxy)-N-[(1R)-1-(2,4-difluorophenyl)ethyl]butanamide (PubChem CID 51952508) has the molecular formula C21H23F2NO4 and a molecular weight of 391.41 g/mol. Its IUPAC name is 4-(4-acetyl-2-methoxyphenoxy)-N-[(1R)-1-(2,4-difluorophenyl)ethyl]butanamide.
| Compound Name | 4-(4-acetyl-2-methoxyphenoxy)-N-[(1R)-1-(2,4-difluorophenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 51952508 |
| Molecular Formula | C21H23F2NO4 |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 4-(4-acetyl-2-methoxyphenoxy)-N-[(1R)-1-(2,4-difluorophenyl)ethyl]butanamide |
| SMILES | COc1cc(C(C)=O)ccc1OCCCC(=O)N[C@H](C)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H23F2NO4/c1-13(17-8-7-16(22)12-18(17)23)24-21(26)5-4-10-28-19-9-6-15(14(2)25)11-20(19)27-3/h6-9,11-13H,4-5,10H2,1-3H3,(H,24,26)/t13-/m1/s1 |
| InChIKey | NAGYEZXUPMFULT-CYBMUJFWSA-N |
| XLogP | 4.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|