C33H43NO3 — CID 14407109
4-[bis(4-methoxyphenyl)methyl]-1-[3-(4-tert-butylphenoxy)propyl]piperidine (PubChem CID 14407109) has the molecular formula C33H43NO3 and a molecular weight of 501.71 g/mol. Its IUPAC name is 4-[bis(4-methoxyphenyl)methyl]-1-[3-(4-tert-butylphenoxy)propyl]piperidine.
| Compound Name | 4-[bis(4-methoxyphenyl)methyl]-1-[3-(4-tert-butylphenoxy)propyl]piperidine |
|---|---|
| PubChem CID | 14407109 |
| Molecular Formula | C33H43NO3 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.32 |
| IUPAC Name | 4-[bis(4-methoxyphenyl)methyl]-1-[3-(4-tert-butylphenoxy)propyl]piperidine |
| SMILES | COc1ccc(C(c2ccc(OC)cc2)C2CCN(CCCOc3ccc(C(C)(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C33H43NO3/c1-33(2,3)28-11-17-31(18-12-28)37-24-6-21-34-22-19-27(20-23-34)32(25-7-13-29(35-4)14-8-25)26-9-15-30(36-5)16-10-26/h7-18,27,32H,6,19-24H2,1-5H3 |
| InChIKey | NECUCOPLSRJZLJ-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|