About 1-[3-(4-fluorophenoxy)propyl]-4-methylpiperidin-4-amine;hydrate;dihydrochloride
1-[3-(4-fluorophenoxy)propyl]-4-methylpiperidin-4-amine;hydrate;dihydrochloride (PubChem CID 21472470) has the molecular formula C15H27Cl2FN2O2
and a molecular weight of 357.30 g/mol. Its IUPAC name is 1-[3-(4-fluorophenoxy)propyl]-4-methylpiperidin-4-amine;hydrate;dihydrochloride.
Molecular Properties
| Compound Name | 1-[3-(4-fluorophenoxy)propyl]-4-methylpiperidin-4-amine;hydrate;dihydrochloride |
| PubChem CID | 21472470 |
| Molecular Formula | C15H27Cl2FN2O2 |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-[3-(4-fluorophenoxy)propyl]-4-methylpiperidin-4-amine;hydrate;dihydrochloride |
| SMILES | CC1(N)CCN(CCCOc2ccc(F)cc2)CC1.Cl.Cl.O |
| InChI | InChI=1S/C15H23FN2O.2ClH.H2O/c1-15(17)7-10-18(11-8-15)9-2-12-19-14-5-3-13(16)4-6-14;;;/h3-6H,2,7-12,17H2,1H3;2*1H;1H2 |
| InChIKey | GMFJOFCZKBHVDJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(4-fluorophenoxy)propyl]-4-methylpiperidin-4-amine;hydrate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(4-fluorophenoxy)propyl]-4-methylpiperidin-4-amine;hydrate;dihydrochloride?
The IUPAC name of 1-[3-(4-fluorophenoxy)propyl]-4-methylpiperidin-4-amine;hydrate;dihydrochloride (CID 21472470) is 1-[3-(4-fluorophenoxy)propyl]-4-methylpiperidin-4-amine;hydrate;dihydrochloride.
What is the SMILES notation for 1-[3-(4-fluorophenoxy)propyl]-4-methylpiperidin-4-amine;hydrate;dihydrochloride?
The canonical SMILES for 1-[3-(4-fluorophenoxy)propyl]-4-methylpiperidin-4-amine;hydrate;dihydrochloride is CC1(N)CCN(CCCOc2ccc(F)cc2)CC1.Cl.Cl.O.
What is the InChIKey of 1-[3-(4-fluorophenoxy)propyl]-4-methylpiperidin-4-amine;hydrate;dihydrochloride?
The InChIKey is GMFJOFCZKBHVDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23FN2O.2ClH.H2O/c1-15(17)7-10-18(11-8-15)9-2-12-19-14-5-3-13(16)4-6-14;;;/h3-6H,2,7-12,17H2,1H3;2*1H;1H2.
What are the key properties of 1-[3-(4-fluorophenoxy)propyl]-4-methylpiperidin-4-amine;hydrate;dihydrochloride?
1-[3-(4-fluorophenoxy)propyl]-4-methylpiperidin-4-amine;hydrate;dihydrochloride has a molecular weight of 357.30 g/mol, XLogP of 2.43, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(4-fluorophenoxy)propyl]-4-methylpiperidin-4-amine;hydrate;dihydrochloride is sourced from PubChem (CID 21472470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).