C23H30FN3O3 — CID 10364537
4-amino-N-[1-[3-(4-fluorophenoxy)propyl]-4-methylpiperidin-4-yl]-2-methoxybenzamide (PubChem CID 10364537) has the molecular formula C23H30FN3O3 and a molecular weight of 415.51 g/mol. Its IUPAC name is 4-amino-N-[1-[3-(4-fluorophenoxy)propyl]-4-methylpiperidin-4-yl]-2-methoxybenzamide.
| Compound Name | 4-amino-N-[1-[3-(4-fluorophenoxy)propyl]-4-methylpiperidin-4-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 10364537 |
| Molecular Formula | C23H30FN3O3 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 4-amino-N-[1-[3-(4-fluorophenoxy)propyl]-4-methylpiperidin-4-yl]-2-methoxybenzamide |
| SMILES | COc1cc(N)ccc1C(=O)NC1(C)CCN(CCCOc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H30FN3O3/c1-23(26-22(28)20-9-6-18(25)16-21(20)29-2)10-13-27(14-11-23)12-3-15-30-19-7-4-17(24)5-8-19/h4-9,16H,3,10-15,25H2,1-2H3,(H,26,28) |
| InChIKey | JSSCAPSSUCIMNO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|