C22H26ClF2N3O3 — CID 66635621
4-amino-5-chloro-N-[(3R,4S)-3-fluoro-1-[3-(4-fluorophenoxy)propyl]piperidin-4-yl]-2-methoxybenzamide (PubChem CID 66635621) has the molecular formula C22H26ClF2N3O3 and a molecular weight of 453.92 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[(3R,4S)-3-fluoro-1-[3-(4-fluorophenoxy)propyl]piperidin-4-yl]-2-methoxybenzamide.
| Compound Name | 4-amino-5-chloro-N-[(3R,4S)-3-fluoro-1-[3-(4-fluorophenoxy)propyl]piperidin-4-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 66635621 |
| Molecular Formula | C22H26ClF2N3O3 |
| Molecular Weight | 453.92 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 4-amino-5-chloro-N-[(3R,4S)-3-fluoro-1-[3-(4-fluorophenoxy)propyl]piperidin-4-yl]-2-methoxybenzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N[C@H]1CCN(CCCOc2ccc(F)cc2)C[C@H]1F |
| InChI | InChI=1S/C22H26ClF2N3O3/c1-30-21-12-19(26)17(23)11-16(21)22(29)27-20-7-9-28(13-18(20)25)8-2-10-31-15-5-3-14(24)4-6-15/h3-6,11-12,18,20H,2,7-10,13,26H2,1H3,(H,27,29)/t18-,20+/m1/s1 |
| InChIKey | RVXOXDUZRGNHIS-QUCCMNQESA-N |
| XLogP | 3.68 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.92 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|