C25H33ClFN3O4S — CID 14372585
4-amino-5-chloro-N-[1-[3-(4-fluorophenoxy)propyl]-3-methoxypiperidin-4-yl]-2-(2-methylsulfanylethoxy)benzamide (PubChem CID 14372585) has the molecular formula C25H33ClFN3O4S and a molecular weight of 526.07 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[1-[3-(4-fluorophenoxy)propyl]-3-methoxypiperidin-4-yl]-2-(2-methylsulfanylethoxy)benzamide.
| Compound Name | 4-amino-5-chloro-N-[1-[3-(4-fluorophenoxy)propyl]-3-methoxypiperidin-4-yl]-2-(2-methylsulfanylethoxy)benzamide |
|---|---|
| PubChem CID | 14372585 |
| Molecular Formula | C25H33ClFN3O4S |
| Molecular Weight | 526.07 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 4-amino-5-chloro-N-[1-[3-(4-fluorophenoxy)propyl]-3-methoxypiperidin-4-yl]-2-(2-methylsulfanylethoxy)benzamide |
| SMILES | COC1CN(CCCOc2ccc(F)cc2)CCC1NC(=O)c1cc(Cl)c(N)cc1OCCSC |
| InChI | InChI=1S/C25H33ClFN3O4S/c1-32-24-16-30(9-3-11-33-18-6-4-17(27)5-7-18)10-8-22(24)29-25(31)19-14-20(26)21(28)15-23(19)34-12-13-35-2/h4-7,14-15,22,24H,3,8-13,16,28H2,1-2H3,(H,29,31) |
| InChIKey | GHKXJBMJAZRRDL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.07 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|