C27H33ClFN3O8 — CID 69130148
4-amino-5-chloro-N-[(3S,4S)-1-[3-(4-fluorophenoxy)propyl]-3-methoxypiperidin-4-yl]-2-methoxybenzamide;but-2-enedioic acid (PubChem CID 69130148) has the molecular formula C27H33ClFN3O8 and a molecular weight of 582.03 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[(3S,4S)-1-[3-(4-fluorophenoxy)propyl]-3-methoxypiperidin-4-yl]-2-methoxybenzamide;but-2-enedioic acid.
| Compound Name | 4-amino-5-chloro-N-[(3S,4S)-1-[3-(4-fluorophenoxy)propyl]-3-methoxypiperidin-4-yl]-2-methoxybenzamide;but-2-enedioic acid |
|---|---|
| PubChem CID | 69130148 |
| Molecular Formula | C27H33ClFN3O8 |
| Molecular Weight | 582.03 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | 4-amino-5-chloro-N-[(3S,4S)-1-[3-(4-fluorophenoxy)propyl]-3-methoxypiperidin-4-yl]-2-methoxybenzamide;but-2-enedioic acid |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N[C@H]1CCN(CCCOc2ccc(F)cc2)C[C@@H]1OC.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C23H29ClFN3O4.C4H4O4/c1-30-21-13-19(26)18(24)12-17(21)23(29)27-20-8-10-28(14-22(20)31-2)9-3-11-32-16-6-4-15(25)5-7-16;5-3(6)1-2-4(7)8/h4-7,12-13,20,22H,3,8-11,14,26H2,1-2H3,(H,27,29);1-2H,(H,5,6)(H,7,8)/t20-,22-;/m0./s1 |
| InChIKey | LCLLKAKAHIJNMG-DTRWSJPISA-N |
| XLogP | 3.07 |
| TPSA | 160.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.03 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|