C108H252O36Si17 — CID 101061227
tetrakis[3-[tris(2-triethoxysilylethyl)silyl]propyl]silane (PubChem CID 101061227) has the molecular formula C108H252O36Si17 and a molecular weight of 2604.63 g/mol. Its IUPAC name is tetrakis[3-[tris(2-triethoxysilylethyl)silyl]propyl]silane.
| Compound Name | tetrakis[3-[tris(2-triethoxysilylethyl)silyl]propyl]silane |
|---|---|
| PubChem CID | 101061227 |
| Molecular Formula | C108H252O36Si17 |
| Molecular Weight | 2604.63 g/mol |
| Exact Mass | 2601.40 |
| IUPAC Name | tetrakis[3-[tris(2-triethoxysilylethyl)silyl]propyl]silane |
| SMILES | CCO[Si](CC[Si](CCC[Si](CCC[Si](CC[Si](OCC)(OCC)OCC)(CC[Si](OCC)(OCC)OCC)CC[Si](OCC)(OCC)OCC)(CCC[Si](CC[Si](OCC)(OCC)OCC)(CC[Si](OCC)(OCC)OCC)CC[Si](OCC)(OCC)OCC)CCC[Si](CC[Si](OCC)(OCC)OCC)(CC[Si](OCC)(OCC)OCC)CC[Si](OCC)(OCC)OCC)(CC[Si](OCC)(OCC)OCC)CC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C108H252O36Si17/c1-37-109-150(110-38-2,111-39-3)97-85-146(86-98-151(112-40-4,113-41-5)114-42-6,87-99-152(115-43-7,116-44-8)117-45-9)81-73-77-145(78-74-82-147(88-100-153(118-46-10,119-47-11)120-48-12,89-101-154(121-49-13,122-50-14)123-51-15)90-102-155(124-52-16,125-53-17)126-54-18,79-75-83-148(91-103-156(127-55-19,128-56-20)129-57-21,92-104-157(130-58-22,131-59-23)132-60-24)93-105-158(133-61-25,134-62-26)135-63-27)80-76-84-149(94-106-159(136-64-28,137-65-29)138-66-30,95-107-160(139-67-31,140-68-32)141-69-33)96-108-161(142-70-34,143-71-35)144-72-36/h37-108H2,1-36H3 |
| InChIKey | WMKKCPSWSPOAQN-UHFFFAOYSA-N |
| XLogP | 27.37 |
| TPSA | 332.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 36 |
| Rotatable Bonds | 124 |
| Heavy Atoms | 161 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 2604.63 |
| LogP ≤ 5 | 27.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 36 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|