C15H26N2O — CID 145241841
2-(diethylamino)acetaldehyde;N,2,6-trimethylaniline (PubChem CID 145241841) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 2-(diethylamino)acetaldehyde;N,2,6-trimethylaniline.
| Compound Name | 2-(diethylamino)acetaldehyde;N,2,6-trimethylaniline |
|---|---|
| PubChem CID | 145241841 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 2-(diethylamino)acetaldehyde;N,2,6-trimethylaniline |
| SMILES | CCN(CC)CC=O.CNc1c(C)cccc1C |
| InChI | InChI=1S/C9H13N.C6H13NO/c1-7-5-4-6-8(2)9(7)10-3;1-3-7(4-2)5-6-8/h4-6,10H,1-3H3;6H,3-5H2,1-2H3 |
| InChIKey | BTNROYDRDGBSFY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|