C10H13N — CID 70358153
N-ethenyl-2,3-dimethylaniline (PubChem CID 70358153) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is N-ethenyl-2,3-dimethylaniline.
| Compound Name | N-ethenyl-2,3-dimethylaniline |
|---|---|
| PubChem CID | 70358153 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | N-ethenyl-2,3-dimethylaniline |
| SMILES | C=CNc1cccc(C)c1C |
| InChI | InChI=1S/C10H13N/c1-4-11-10-7-5-6-8(2)9(10)3/h4-7,11H,1H2,2-3H3 |
| InChIKey | XTMQMOKUNPFONN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |