C15H12Cl2N2O6 — CID 4121365
(2-chloro-4-nitrophenyl) N-(5-chloro-2,4-dimethoxyphenyl)carbamate (PubChem CID 4121365) has the molecular formula C15H12Cl2N2O6 and a molecular weight of 387.18 g/mol. Its IUPAC name is (2-chloro-4-nitrophenyl) N-(5-chloro-2,4-dimethoxyphenyl)carbamate.
| Compound Name | (2-chloro-4-nitrophenyl) N-(5-chloro-2,4-dimethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 4121365 |
| Molecular Formula | C15H12Cl2N2O6 |
| Molecular Weight | 387.18 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | (2-chloro-4-nitrophenyl) N-(5-chloro-2,4-dimethoxyphenyl)carbamate |
| SMILES | COc1cc(OC)c(NC(=O)Oc2ccc([N+](=O)[O-])cc2Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl2N2O6/c1-23-13-7-14(24-2)11(6-10(13)17)18-15(20)25-12-4-3-8(19(21)22)5-9(12)16/h3-7H,1-2H3,(H,18,20) |
| InChIKey | UJKGJINROAUFHR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.18 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|