C16H14F2N2O4 — CID 18085786
2-[2-(3,4-difluoroanilino)-2-oxoethoxy]-4-methoxybenzamide (PubChem CID 18085786) has the molecular formula C16H14F2N2O4 and a molecular weight of 336.29 g/mol. Its IUPAC name is 2-[2-(3,4-difluoroanilino)-2-oxoethoxy]-4-methoxybenzamide.
| Compound Name | 2-[2-(3,4-difluoroanilino)-2-oxoethoxy]-4-methoxybenzamide |
|---|---|
| PubChem CID | 18085786 |
| Molecular Formula | C16H14F2N2O4 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-[2-(3,4-difluoroanilino)-2-oxoethoxy]-4-methoxybenzamide |
| SMILES | COc1ccc(C(N)=O)c(OCC(=O)Nc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C16H14F2N2O4/c1-23-10-3-4-11(16(19)22)14(7-10)24-8-15(21)20-9-2-5-12(17)13(18)6-9/h2-7H,8H2,1H3,(H2,19,22)(H,20,21) |
| InChIKey | VUHZGMAUIOGFBG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |