C18H19FN2O4 — CID 18085820
2-[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethoxy]-4-methoxybenzamide (PubChem CID 18085820) has the molecular formula C18H19FN2O4 and a molecular weight of 346.36 g/mol. Its IUPAC name is 2-[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethoxy]-4-methoxybenzamide.
| Compound Name | 2-[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethoxy]-4-methoxybenzamide |
|---|---|
| PubChem CID | 18085820 |
| Molecular Formula | C18H19FN2O4 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2-[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethoxy]-4-methoxybenzamide |
| SMILES | COc1ccc(C(N)=O)c(OCC(=O)NCCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H19FN2O4/c1-24-14-6-7-15(18(20)23)16(10-14)25-11-17(22)21-9-8-12-2-4-13(19)5-3-12/h2-7,10H,8-9,11H2,1H3,(H2,20,23)(H,21,22) |
| InChIKey | IDIWRGCURIDCLF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |