C16H18FNO3 — CID 107593812
4-fluoro-2-methyl-5-(2,3,4-trimethoxyphenyl)aniline (PubChem CID 107593812) has the molecular formula C16H18FNO3 and a molecular weight of 291.32 g/mol. Its IUPAC name is 4-fluoro-2-methyl-5-(2,3,4-trimethoxyphenyl)aniline.
| Compound Name | 4-fluoro-2-methyl-5-(2,3,4-trimethoxyphenyl)aniline |
|---|---|
| PubChem CID | 107593812 |
| Molecular Formula | C16H18FNO3 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 4-fluoro-2-methyl-5-(2,3,4-trimethoxyphenyl)aniline |
| SMILES | COc1ccc(-c2cc(N)c(C)cc2F)c(OC)c1OC |
| InChI | InChI=1S/C16H18FNO3/c1-9-7-12(17)11(8-13(9)18)10-5-6-14(19-2)16(21-4)15(10)20-3/h5-8H,18H2,1-4H3 |
| InChIKey | FSKXYBKJYQGKHX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|