C10H9FO3 — CID 55269506
5-fluoro-6-methoxy-2,3-dihydrochromen-4-one (PubChem CID 55269506) has the molecular formula C10H9FO3 and a molecular weight of 196.18 g/mol. Its IUPAC name is 5-fluoro-6-methoxy-2,3-dihydrochromen-4-one.
| Compound Name | 5-fluoro-6-methoxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 55269506 |
| Molecular Formula | C10H9FO3 |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 5-fluoro-6-methoxy-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc2c(c1F)C(=O)CCO2 |
| InChI | InChI=1S/C10H9FO3/c1-13-8-3-2-7-9(10(8)11)6(12)4-5-14-7/h2-3H,4-5H2,1H3 |
| InChIKey | JOOKFGBZBBBUTB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |