C9H8O4 — CID 91664860
5,6-dihydroxy-2,3-dihydrochromen-4-one (PubChem CID 91664860) has the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. Its IUPAC name is 5,6-dihydroxy-2,3-dihydrochromen-4-one.
| Compound Name | 5,6-dihydroxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 91664860 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 5,6-dihydroxy-2,3-dihydrochromen-4-one |
| SMILES | O=C1CCOc2ccc(O)c(O)c21 |
| InChI | InChI=1S/C9H8O4/c10-5-3-4-13-7-2-1-6(11)9(12)8(5)7/h1-2,11-12H,3-4H2 |
| InChIKey | YWCRTOQATVKHKD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|