C16H21NO5 — CID 159253373
2-[(5-amino-4-oxo-2,3-dihydrochromen-6-yl)oxy]ethyl 2-methylprop-2-enoate;methane (PubChem CID 159253373) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-[(5-amino-4-oxo-2,3-dihydrochromen-6-yl)oxy]ethyl 2-methylprop-2-enoate;methane.
| Compound Name | 2-[(5-amino-4-oxo-2,3-dihydrochromen-6-yl)oxy]ethyl 2-methylprop-2-enoate;methane |
|---|---|
| PubChem CID | 159253373 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-[(5-amino-4-oxo-2,3-dihydrochromen-6-yl)oxy]ethyl 2-methylprop-2-enoate;methane |
| SMILES | C.C=C(C)C(=O)OCCOc1ccc2c(c1N)C(=O)CCO2 |
| InChI | InChI=1S/C15H17NO5.CH4/c1-9(2)15(18)21-8-7-20-12-4-3-11-13(14(12)16)10(17)5-6-19-11;/h3-4H,1,5-8,16H2,2H3;1H4 |
| InChIKey | KVOSTALLXUQKRC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|